The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8846730, 53 ID: ALA3686312
PubChem CID: 68553404
Max Phase: Preclinical
Molecular Formula: C26H33F4N3O3S
Molecular Weight: 543.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN1C[C@@H](F)C[C@H]1COc1ccc(C(F)(F)F)cc1C(=O)/N=c1\sc(C(C)(C)C)cn1C[C@H]1CCCO1
Standard InChI: InChI=1S/C26H33F4N3O3S/c1-25(2,3)22-14-33(13-19-6-5-9-35-19)24(37-22)31-23(34)20-10-16(26(28,29)30)7-8-21(20)36-15-18-11-17(27)12-32(18)4/h7-8,10,14,17-19H,5-6,9,11-13,15H2,1-4H3/b31-24-/t17-,18-,19+/m0/s1
Standard InChI Key: NZYBJQJYFGAOPV-JZAPAQGHSA-N
Molfile:
RDKit 2D
37 40 0 0 1 0 0 0 0 0999 V2000
6.7942 0.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5517 -0.8722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5554 -1.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8054 -3.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2935 -4.3822 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.3382 -2.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0351 -3.6026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0934 -6.1101 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.5570 -7.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0570 -7.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5205 -6.1100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9427 -5.6391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0643 -6.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5139 -6.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2694 -7.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2704 -8.7186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8975 -8.1142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3237 -8.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5172 -8.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1648 -9.8448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0285 -9.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5988 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5996 2.7004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6378 0.9001 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6383 2.0999 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 1
4 6 1 0
6 7 1 0
7 2 1 0
7 8 1 1
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 1 0
23 24 1 0
25 24 1 6
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 25 1 0
21 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
13 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 543.63Molecular Weight (Monoisotopic): 543.2179AlogP: 5.21#Rotatable Bonds: 6Polar Surface Area: 56.06Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.26CX LogP: 5.05CX LogD: 5.02Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.47Np Likeness Score: -1.04
References 1. (2014) Compounds as cannabinoid receptor ligands,