The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8846730, 66 ID: ALA3686319
PubChem CID: 68556608
Max Phase: Preclinical
Molecular Formula: C25H32F3N3O4S
Molecular Weight: 527.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1cn(C[C@H]2CCCO2)/c(=N/C(=O)c2cc(C(F)(F)F)ccc2OC[C@@H]2CNCCO2)s1
Standard InChI: InChI=1S/C25H32F3N3O4S/c1-24(2,3)21-14-31(13-17-5-4-9-33-17)23(36-21)30-22(32)19-11-16(25(26,27)28)6-7-20(19)35-15-18-12-29-8-10-34-18/h6-7,11,14,17-18,29H,4-5,8-10,12-13,15H2,1-3H3/b30-23-/t17-,18+/m1/s1
Standard InChI Key: VEEBDDVPCWFAEJ-ARSAIXRZSA-N
Molfile:
RDKit 2D
36 39 0 0 1 0 0 0 0 0999 V2000
8.6082 -4.7808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4148 -4.6546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7092 -5.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9024 -5.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8054 -3.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5554 -1.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5517 -0.8722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8550 0.5950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2794 1.0677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7162 2.4894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2162 2.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6857 1.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4759 0.1843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6024 -2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6060 -6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6060 -7.5003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -8.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0080 -7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0079 -6.0003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0388 3.6015 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.0394 3.6005 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.0006 4.2008 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.3382 -2.9741 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
9 8 1 1
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 9 1 0
7 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
24 25 1 0
26 25 1 1
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 26 1 0
20 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
14 36 1 0
36 5 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.61Molecular Weight (Monoisotopic): 527.2066AlogP: 4.15#Rotatable Bonds: 6Polar Surface Area: 74.08Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.09CX LogP: 4.30CX LogD: 3.53Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.61Np Likeness Score: -1.08
References 1. (2014) Compounds as cannabinoid receptor ligands,