The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8846730, 75 ID: ALA3686326
PubChem CID: 87347869
Max Phase: Preclinical
Molecular Formula: C22H26F3N3O4S
Molecular Weight: 485.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)NOc1ccc(C(F)(F)F)cc1C(=O)/N=c1\sc(C(C)(C)C)cn1C[C@H]1CCCO1
Standard InChI: InChI=1S/C22H26F3N3O4S/c1-13(29)27-32-17-8-7-14(22(23,24)25)10-16(17)19(30)26-20-28(11-15-6-5-9-31-15)12-18(33-20)21(2,3)4/h7-8,10,12,15H,5-6,9,11H2,1-4H3,(H,27,29)/b26-20-/t15-/m1/s1
Standard InChI Key: UDTOPTBWPAEPKX-XXQDRHBBSA-N
Molfile:
RDKit 2D
33 35 0 0 1 0 0 0 0 0999 V2000
5.2024 -2.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2387 -0.8917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0351 -3.6026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0934 -6.1101 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.5570 -7.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0570 -7.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5205 -6.1100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9427 -5.6391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0643 -6.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5139 -6.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2694 -7.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2704 -8.7186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8975 -8.1142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3237 -8.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5172 -8.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1648 -9.8448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0285 -9.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5988 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5996 2.7004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6378 0.9001 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6383 2.0999 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
11 12 1 0
12 13 2 0
12 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 1 0
19 20 1 0
21 20 1 6
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 21 1 0
17 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
9 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.53Molecular Weight (Monoisotopic): 485.1596AlogP: 4.22#Rotatable Bonds: 5Polar Surface Area: 81.92Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.34CX Basic pKa: ┄CX LogP: 4.01CX LogD: 3.97Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.64Np Likeness Score: -1.15
References 1. (2014) Compounds as cannabinoid receptor ligands,