US8846730, 81

ID: ALA3686331

PubChem CID: 68557610

Max Phase: Preclinical

Molecular Formula: C23H29F3N2O4S

Molecular Weight: 486.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H](O)COc1ccc(C(F)(F)F)cc1C(=O)/N=c1\sc(C(C)(C)C)cn1C[C@H]1CCCO1

Standard InChI:  InChI=1S/C23H29F3N2O4S/c1-14(29)13-32-18-8-7-15(23(24,25)26)10-17(18)20(30)27-21-28(11-16-6-5-9-31-16)12-19(33-21)22(2,3)4/h7-8,10,12,14,16,29H,5-6,9,11,13H2,1-4H3/b27-21-/t14-,16-/m1/s1

Standard InChI Key:  WUGRYZHMXHGXEJ-BXPGOIPJSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  1  0  0  0  0  0999 V2000
    5.2024   -2.6932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2387   -0.8917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0351   -3.6026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0934   -6.1101    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5570   -7.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0570   -7.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5205   -6.1100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9427   -5.6391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0643   -6.6363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5139   -6.3038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2694   -7.5997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2704   -8.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8975   -8.1142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3237   -8.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5172   -8.6241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1648   -9.8448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0285   -9.7199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5988    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5996    2.7004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6378    0.9001    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6383    2.0999    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
 19 20  1  0
 21 20  1  6
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 21  1  0
 17 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
  9 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
M  END

Associated Targets(Human)

CNR2 Tchem Cannabinoid CB2 receptor (16942 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cnr2 Cannabinoid CB2 receptor (721 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 486.56Molecular Weight (Monoisotopic): 486.1800AlogP: 4.55#Rotatable Bonds: 6
Polar Surface Area: 73.05Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.86CX LogP: 4.55CX LogD: 4.55
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.65Np Likeness Score: -1.11

References

1.  (2014)  Compounds as cannabinoid receptor ligands, 

Source

Source(1):