The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8846730, 83 ID: ALA3686332
PubChem CID: 87350406
Max Phase: Preclinical
Molecular Formula: C25H30F3N3O3S
Molecular Weight: 509.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1cn(CC2CCCO2)/c(=N/C(=O)c2cc(C(F)(F)F)ccc2ON=C2CCCC2)s1
Standard InChI: InChI=1S/C25H30F3N3O3S/c1-24(2,3)21-15-31(14-18-9-6-12-33-18)23(35-21)29-22(32)19-13-16(25(26,27)28)10-11-20(19)34-30-17-7-4-5-8-17/h10-11,13,15,18H,4-9,12,14H2,1-3H3/b29-23-
Standard InChI Key: XDYCNZCVBNZQBA-FAJYDZGRSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
8.6082 -4.7808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4148 -4.6546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7092 -5.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9024 -5.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8054 -3.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5554 -1.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5517 -0.8722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8550 0.5950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2794 1.0677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7162 2.4894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2162 2.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6857 1.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4759 0.1843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6024 -2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5205 -6.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0570 -7.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5570 -7.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0934 -6.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0388 3.6015 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.0394 3.6005 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.0006 4.2008 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.3382 -2.9741 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 9 1 0
7 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 26 1 0
20 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
14 35 1 0
35 5 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.59Molecular Weight (Monoisotopic): 509.1960AlogP: 6.09#Rotatable Bonds: 5Polar Surface Area: 65.18Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.15CX LogP: 6.10CX LogD: 6.10Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.46Np Likeness Score: -1.14
References 1. (2014) Compounds as cannabinoid receptor ligands,