US8846730, 84

ID: ALA3686333

PubChem CID: 87495543

Max Phase: Preclinical

Molecular Formula: C24H28F3N3O4S

Molecular Weight: 511.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)/C(C)=N/Oc1ccc(C(F)(F)F)cc1C(=O)/N=c1\sc(C(C)(C)C)cn1C[C@H]1CCCO1

Standard InChI:  InChI=1S/C24H28F3N3O4S/c1-14(15(2)31)29-34-19-9-8-16(24(25,26)27)11-18(19)21(32)28-22-30(12-17-7-6-10-33-17)13-20(35-22)23(3,4)5/h8-9,11,13,17H,6-7,10,12H2,1-5H3/b28-22-,29-14+/t17-/m1/s1

Standard InChI Key:  FBADXWSLVVNEBY-WRIAJGEMSA-N

Molfile:  

     RDKit          2D

 35 37  0  0  1  0  0  0  0  0999 V2000
    6.4969    0.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4990   -0.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5395   -1.3388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0351   -3.6026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0934   -6.1101    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5570   -7.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0570   -7.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5205   -6.1100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9427   -5.6391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0643   -6.6363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5139   -6.3038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2694   -7.5997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2704   -8.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8975   -8.1142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3237   -8.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5172   -8.6241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1648   -9.8448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0285   -9.7199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5988    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5996    2.7004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6378    0.9001    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6383    2.0999    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.2024   -2.6932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  1  0
 20 21  1  0
 22 21  1  6
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 22  1  0
 18 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
 10 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
  4 35  1  0
M  END

Associated Targets(Human)

CNR2 Tchem Cannabinoid CB2 receptor (16942 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cnr2 Cannabinoid CB2 receptor (721 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.57Molecular Weight (Monoisotopic): 511.1753AlogP: 5.13#Rotatable Bonds: 6
Polar Surface Area: 82.25Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.45CX LogD: 5.45
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: -0.98

References

1.  (2014)  Compounds as cannabinoid receptor ligands, 

Source

Source(1):