US8846730, 34

ID: ALA3686337

PubChem CID: 91808090

Max Phase: Preclinical

Molecular Formula: C27H37F3N4O3S

Molecular Weight: 554.68

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCN(C)[C@@H](COc2ccc(C(F)(F)F)cc2C(=O)/N=c2\sc(C(C)(C)C)cn2C[C@H]2CCCO2)C1

Standard InChI:  InChI=1S/C27H37F3N4O3S/c1-26(2,3)23-16-34(15-20-7-6-12-36-20)25(38-23)31-24(35)21-13-18(27(28,29)30)8-9-22(21)37-17-19-14-32(4)10-11-33(19)5/h8-9,13,16,19-20H,6-7,10-12,14-15,17H2,1-5H3/b31-25-/t19-,20-/m1/s1

Standard InChI Key:  CJQVHJZPYRBXFN-YBRZPMKISA-N

Molfile:  

     RDKit          2D

 38 41  0  0  1  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003   -1.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990   -0.7455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2004   -2.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4995   -3.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7985   -2.9932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7985   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4994   -0.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5025    0.7576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4643    1.3594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8033    1.5061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8064    3.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5929    3.8668    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0565    5.2934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5565    5.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0200    3.8667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4422    3.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.5638    4.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.0134    4.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7689    5.3563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7699    6.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.3970    5.8709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1759    6.5055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9823    6.3808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6643    7.6016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4710    7.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0983   -3.7436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0991   -4.9436    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1373   -3.1433    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1378   -4.3431    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  6
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
 23 24  1  0
 25 24  1  1
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 25  1  0
 21 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
 13 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
  7 38  1  0
 38  2  1  0
M  END

Associated Targets(Human)

CNR2 Tchem Cannabinoid CB2 receptor (16942 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cnr2 Cannabinoid CB2 receptor (721 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 554.68Molecular Weight (Monoisotopic): 554.2538AlogP: 4.41#Rotatable Bonds: 6
Polar Surface Area: 59.30Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.86CX LogP: 4.75CX LogD: 4.64
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.53Np Likeness Score: -1.14

References

1.  (2014)  Compounds as cannabinoid receptor ligands, 

Source

Source(1):