US8871934, 706

ID: ALA3686491

PubChem CID: 46190788

Max Phase: Preclinical

Molecular Formula: C21H19F3N2O4

Molecular Weight: 420.39

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  OCC(CO)(CO)n1cc(-c2cccc3c2-c2ccccc2C3(O)C(F)(F)F)cn1

Standard InChI:  InChI=1S/C21H19F3N2O4/c22-21(23,24)20(30)16-6-2-1-4-15(16)18-14(5-3-7-17(18)20)13-8-25-26(9-13)19(10-27,11-28)12-29/h1-9,27-30H,10-12H2

Standard InChI Key:  FRUWPMXPEGNARK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    8.5180   -2.9350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3243   -3.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4433   -1.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0555   -0.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2490   -0.3486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9649   -1.6834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4535   -0.5874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9531   -1.9978    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9511   -0.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7343   -2.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2010   -3.2956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5701   -4.1788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0400   -5.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5318   -5.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4135   -4.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133   -1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2021   -2.6573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8502   -0.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0475    0.5610    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2212    0.8101    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0240   -0.0816    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  3  6  1  0
  6  7  1  0
  3  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 10 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 24 25  1  0
 25 17  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
M  END

Associated Targets(Human)

PDK2 Tchem Pyruvate dehydrogenase kinase isoform 2 (894 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.39Molecular Weight (Monoisotopic): 420.1297AlogP: 2.00#Rotatable Bonds: 5
Polar Surface Area: 98.74Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 10.11CX Basic pKa: 1.47CX LogP: 1.39CX LogD: 1.39
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.51Np Likeness Score: -0.21

References

1.  (2014)  Fluorene compound and pharmaceutical use thereof, 

Source

Source(1):