US8871934, 707

ID: ALA3686492

PubChem CID: 46191618

Max Phase: Preclinical

Molecular Formula: C22H21F3N2O4

Molecular Weight: 434.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2cnn(C(CO)(CO)CO)c2)c2c(c1)C(O)(C(F)(F)F)c1ccccc1-2

Standard InChI:  InChI=1S/C22H21F3N2O4/c1-13-6-16(14-8-26-27(9-14)20(10-28,11-29)12-30)19-15-4-2-3-5-17(15)21(31,18(19)7-13)22(23,24)25/h2-9,28-31H,10-12H2,1H3

Standard InChI Key:  XNSPIQJDTPKNAN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2121    3.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7463    5.2884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7537    5.2860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2149    3.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6362    6.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0288    7.8691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7357    8.8388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1285    6.3370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8363    7.3060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1153    6.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3693    7.7602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248    1.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3339    2.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8257    2.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7073    1.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0972    0.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6065    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248   -1.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9023   -1.4445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7118   -2.3028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5379   -2.0537    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9090   -3.1947    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0826   -3.4441    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9  5  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
 13 14  1  0
 10 15  1  0
 15 16  1  0
  4 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 26 17  1  0
 26 27  2  0
 27  2  1  0
 24 28  1  0
 28 29  1  0
 28 30  1  0
 28 31  1  0
M  END

Associated Targets(Human)

PDK2 Tchem Pyruvate dehydrogenase kinase isoform 2 (894 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.41Molecular Weight (Monoisotopic): 434.1453AlogP: 2.31#Rotatable Bonds: 5
Polar Surface Area: 98.74Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 10.12CX Basic pKa: 1.47CX LogP: 1.91CX LogD: 1.91
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -0.23

References

1.  (2014)  Fluorene compound and pharmaceutical use thereof, 

Source

Source(1):