The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8933079, 9.4 ID: ALA3686857
PubChem CID: 71730792
Max Phase: Preclinical
Molecular Formula: C22H24N4O4
Molecular Weight: 408.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNCc1ccc(C(=O)Cn2ncc(OCc3ccc(OC)cn3)cc2=O)c(C)c1
Standard InChI: InChI=1S/C22H24N4O4/c1-15-8-16(10-23-2)4-7-20(15)21(27)13-26-22(28)9-19(12-25-26)30-14-17-5-6-18(29-3)11-24-17/h4-9,11-12,23H,10,13-14H2,1-3H3
Standard InChI Key: FLTSKMOUOHOQGD-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
3.6331 -3.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5973 1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6375 0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 3.7570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1925 3.0070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4915 3.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4915 5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1924 6.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8934 5.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8542 5.8570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7897 6.0102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7875 7.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0857 8.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0857 9.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3847 10.5142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6838 9.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9851 10.5121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-14.0235 9.9106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6839 8.2643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3849 7.5142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 -1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 11 1 0
16 17 2 0
14 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
23 26 1 0
26 27 2 0
27 20 1 0
7 28 1 0
28 29 1 0
28 30 2 0
30 4 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.46Molecular Weight (Monoisotopic): 408.1798AlogP: 2.14#Rotatable Bonds: 9Polar Surface Area: 95.34Molecular Species: BASEHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.10CX LogP: 1.27CX LogD: -0.43Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.54Np Likeness Score: -1.19
References 1. (2015) Pyridone and pyridazinone derivatives as anti-obesity agents,