The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8933079, 11.3 ID: ALA3686859
PubChem CID: 91759589
Max Phase: Preclinical
Molecular Formula: C26H29N3O4
Molecular Weight: 447.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(COc2ccn(CC(=O)c3ccc(CN4CCCC4)cc3C)c(=O)c2)nc1
Standard InChI: InChI=1S/C26H29N3O4/c1-19-13-20(16-28-10-3-4-11-28)5-8-24(19)25(30)17-29-12-9-22(14-26(29)31)33-18-21-6-7-23(32-2)15-27-21/h5-9,12-15H,3-4,10-11,16-18H2,1-2H3
Standard InChI Key: WOJJCWUUTIVMAS-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
2.5956 -2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4994 0.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7985 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8377 0.8932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7985 2.9932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.0967 3.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0947 5.2471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0544 5.8453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.3929 6.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6920 5.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9910 6.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9910 7.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2893 8.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2871 9.7540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-15.4976 10.6181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.0292 12.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.5292 12.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.0706 10.6097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6920 8.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3930 7.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.3538 8.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4995 3.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2004 2.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 22 1 0
20 27 1 0
27 28 2 0
28 17 1 0
28 29 1 0
13 30 1 0
30 31 2 0
31 9 1 0
6 32 1 0
32 33 2 0
33 3 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.54Molecular Weight (Monoisotopic): 447.2158AlogP: 3.62#Rotatable Bonds: 9Polar Surface Area: 73.66Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.32CX LogP: 2.48CX LogD: 1.51Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -1.42
References 1. (2015) Pyridone and pyridazinone derivatives as anti-obesity agents,