US8933079, 11.3

ID: ALA3686859

PubChem CID: 91759589

Max Phase: Preclinical

Molecular Formula: C26H29N3O4

Molecular Weight: 447.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(COc2ccn(CC(=O)c3ccc(CN4CCCC4)cc3C)c(=O)c2)nc1

Standard InChI:  InChI=1S/C26H29N3O4/c1-19-13-20(16-28-10-3-4-11-28)5-8-24(19)25(30)17-29-12-9-22(14-26(29)31)33-18-21-6-7-23(32-2)15-27-21/h5-9,12-15H,3-4,10-11,16-18H2,1-2H3

Standard InChI Key:  WOJJCWUUTIVMAS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    2.5956   -2.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2003    1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4994    0.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7985    1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8377    0.8932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7985    2.9932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0967    3.7462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0947    5.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0544    5.8453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3929    6.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6920    5.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9910    6.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9910    7.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.2893    8.2532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.2871    9.7540    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -15.4976   10.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.0292   12.0431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.5292   12.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.0706   10.6097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6920    8.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3930    7.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.3538    8.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4995    3.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2004    2.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 22  1  0
 20 27  1  0
 27 28  2  0
 28 17  1  0
 28 29  1  0
 13 30  1  0
 30 31  2  0
 31  9  1  0
  6 32  1  0
 32 33  2  0
 33  3  1  0
M  END

Associated Targets(Human)

MCHR1 Tchem Melanin-concentrating hormone receptor 1 (5587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.54Molecular Weight (Monoisotopic): 447.2158AlogP: 3.62#Rotatable Bonds: 9
Polar Surface Area: 73.66Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.32CX LogP: 2.48CX LogD: 1.51
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -1.42

References

1.  (2015)  Pyridone and pyridazinone derivatives as anti-obesity agents, 

Source

Source(1):