The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8933079, 11.4 ID: ALA3686860
PubChem CID: 91759590
Max Phase: Preclinical
Molecular Formula: C24H27N3O4
Molecular Weight: 421.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCNCc1ccc(C(=O)Cn2ccc(OCc3ccc(OC)cn3)cc2=O)c(C)c1
Standard InChI: InChI=1S/C24H27N3O4/c1-4-25-13-18-5-8-22(17(2)11-18)23(28)15-27-10-9-20(12-24(27)29)31-16-19-6-7-21(30-3)14-26-19/h5-12,14,25H,4,13,15-16H2,1-3H3
Standard InChI Key: FNSOKKMYPMNPOG-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
3.8916 -4.9570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5973 1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6375 0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 3.7570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1925 3.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4915 3.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4915 5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1924 6.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8934 5.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8542 5.8570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7897 6.0102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7875 7.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0857 8.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0857 9.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3847 10.5142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6838 9.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9851 10.5121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-14.0235 9.9106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6839 8.2643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3849 7.5142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 -1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 12 1 0
17 18 2 0
15 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 2 0
28 21 1 0
8 29 1 0
29 30 1 0
29 31 2 0
31 5 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 421.50Molecular Weight (Monoisotopic): 421.2002AlogP: 3.13#Rotatable Bonds: 10Polar Surface Area: 82.45Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.19CX LogP: 2.05CX LogD: 0.27Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -1.19
References 1. (2015) Pyridone and pyridazinone derivatives as anti-obesity agents,