US8933079, 7.4

ID: ALA3686861

PubChem CID: 91759578

Max Phase: Preclinical

Molecular Formula: C25H28ClN5O3

Molecular Weight: 481.98

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(CN2CCN(C)CC2)ccc1C(=O)Cn1ncc(OCc2ccc(Cl)cn2)cc1=O

Standard InChI:  InChI=1S/C25H28ClN5O3/c1-18-11-19(15-30-9-7-29(2)8-10-30)3-6-23(18)24(32)16-31-25(33)12-22(14-28-31)34-17-21-5-4-20(26)13-27-21/h3-6,11-14H,7-10,15-17H2,1-2H3

Standard InChI Key:  NVMGJPZLMLOPEY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2007    1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4972    0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4920   -0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7907   -1.5158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7886   -2.7158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0919   -0.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3906   -1.5203    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3856   -3.0204    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6820   -3.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9836   -3.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9888   -1.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6923   -0.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6965    0.4251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -14.2823   -3.7815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -15.5836   -3.0337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.8823   -3.7859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.1840   -3.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -19.4805   -3.7948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -19.4753   -5.2948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -20.5125   -5.8984    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  -18.1737   -6.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.8773   -5.2860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1903   -1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1862   -2.7091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8939   -0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 14  1  0
 19 20  2  0
 17 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 26 28  1  0
 28 29  2  0
 29 23  1  0
 10 30  1  0
 30 31  1  0
 30 32  2  0
 32  7  1  0
  5 33  1  0
 33 34  1  0
 34  2  1  0
M  END

Associated Targets(Human)

MCHR1 Tchem Melanin-concentrating hormone receptor 1 (5587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 481.98Molecular Weight (Monoisotopic): 481.1881AlogP: 2.81#Rotatable Bonds: 8
Polar Surface Area: 80.56Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.19CX LogP: 2.26CX LogD: 2.05
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -1.82

References

1.  (2015)  Pyridone and pyridazinone derivatives as anti-obesity agents, 

Source

Source(1):