US8969335, A29

ID: ALA3687171

PubChem CID: 71295280

Max Phase: Preclinical

Molecular Formula: C29H34N6O4

Molecular Weight: 530.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#Cc1cc(-c2ccnc(Nc3cnn(CCC4CCN(C(=O)CO)CC4)c3)c2)ccc1OC1CCOCC1

Standard InChI:  InChI=1S/C29H34N6O4/c30-17-24-15-22(1-2-27(24)39-26-7-13-38-14-8-26)23-3-9-31-28(16-23)33-25-18-32-35(19-25)12-6-21-4-10-34(11-5-21)29(37)20-36/h1-3,9,15-16,18-19,21,26,36H,4-8,10-14,20H2,(H,31,33)

Standard InChI Key:  PNYUSFRZJAPJCP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    3.6331   -3.6060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2003    1.4932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5517    0.8722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5554    1.9869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0458    1.8333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9262    3.0488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4186    2.8973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.2960    4.1138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6812    5.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1888    5.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.3114    4.4171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7891    3.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.4062    2.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.8988    2.4457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.7743    3.6636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.2674    3.5112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -18.8828    2.1424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -20.3749    1.9879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -20.9872    0.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -20.1074   -0.5964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -18.6154   -0.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.0031    0.9274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.1573    5.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.6647    5.1801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -17.0333    6.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -17.7337    7.2239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8054    3.2859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3382    2.9741    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 17 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 26  1  0
 24 32  1  0
 32 33  2  0
 33 21  1  0
 32 34  1  0
 34 35  3  0
 13 36  1  0
 36 37  2  0
 37 11  1  0
  8 38  1  0
 38 39  1  0
 39  5  1  0
M  END

Associated Targets(Human)

IKBKE Tchem Inhibitor of nuclear factor kappa B kinase epsilon subunit (3311 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TBK1 Tchem Serine/threonine-protein kinase TBK1 (3746 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 530.63Molecular Weight (Monoisotopic): 530.2642AlogP: 3.74#Rotatable Bonds: 9
Polar Surface Area: 125.53Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.52CX Basic pKa: 5.04CX LogP: 1.79CX LogD: 1.79
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.43Np Likeness Score: -1.11

References

1.  (2015)  Benzonitrile derivatives as kinase inhibitors, 

Source

Source(1):