The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8969335, A30 ID: ALA3687172
PubChem CID: 71295242
Max Phase: Preclinical
Molecular Formula: C29H35N7O3
Molecular Weight: 529.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1cc(-c2ccnc(Nc3cnn(CCC4CCN(C(=O)CN)CC4)c3)c2)ccc1OC1CCOCC1
Standard InChI: InChI=1S/C29H35N7O3/c30-17-24-15-22(1-2-27(24)39-26-7-13-38-14-8-26)23-3-9-32-28(16-23)34-25-19-33-36(20-25)12-6-21-4-10-35(11-5-21)29(37)18-31/h1-3,9,15-16,19-21,26H,4-8,10-14,18,31H2,(H,32,34)
Standard InChI Key: HWCQSDRAAGDSRX-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
3.6331 -3.6060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.5517 0.8722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5554 1.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0458 1.8333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.9262 3.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4186 2.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.2960 4.1138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6812 5.4820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1888 5.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.3114 4.4171 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-13.7891 3.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.4062 2.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.8988 2.4457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.7743 3.6636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-18.2674 3.5112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-18.8828 2.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-20.3749 1.9879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-20.9872 0.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-20.1074 -0.5964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-18.6154 -0.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-18.0031 0.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.1573 5.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.6647 5.1801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.0333 6.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.7337 7.2239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.8054 3.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3382 2.9741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
17 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 26 1 0
24 32 1 0
32 33 2 0
33 21 1 0
32 34 1 0
34 35 3 0
13 36 1 0
36 37 2 0
37 11 1 0
8 38 1 0
38 39 1 0
39 5 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.65Molecular Weight (Monoisotopic): 529.2801AlogP: 3.71#Rotatable Bonds: 9Polar Surface Area: 131.32Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.13CX LogP: 1.68CX LogD: 0.88Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.43Np Likeness Score: -1.21
References 1. (2015) Benzonitrile derivatives as kinase inhibitors,