The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8969335, A31 ID: ALA3687173
PubChem CID: 71295250
Max Phase: Preclinical
Molecular Formula: C24H26N4O3
Molecular Weight: 418.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1cc(Nc2cc(-c3ccc(OC4CCOCC4)c(C#N)c3)ccn2)on1
Standard InChI: InChI=1S/C24H26N4O3/c1-24(2,3)21-14-23(31-28-21)27-22-13-17(6-9-26-22)16-4-5-20(18(12-16)15-25)30-19-7-10-29-11-8-19/h4-6,9,12-14,19H,7-8,10-11H2,1-3H3,(H,26,27)
Standard InChI Key: IVAFRTWUCSWUMI-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
5.4075 -6.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2136 -6.5081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7213 -7.6025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9151 -7.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3372 -5.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8056 -3.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2978 3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2954 5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0048 6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0041 7.5017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2955 8.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2984 9.7524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5989 10.4999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8965 9.7475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8937 8.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5933 7.4999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3026 5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3002 3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6036 5.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6438 6.5955 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3786 -3.8595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8372 -5.2877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
11 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 20 1 0
18 26 1 0
26 27 2 0
27 15 1 0
26 28 1 0
28 29 3 0
7 30 1 0
30 31 1 0
31 5 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.50Molecular Weight (Monoisotopic): 418.2005AlogP: 5.21#Rotatable Bonds: 5Polar Surface Area: 93.20Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.20CX Basic pKa: 3.15CX LogP: 4.48CX LogD: 4.47Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.61Np Likeness Score: -0.90
References 1. (2015) Benzonitrile derivatives as kinase inhibitors,