The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8969335, A39 ID: ALA3687180
PubChem CID: 71295079
Max Phase: Preclinical
Molecular Formula: C25H29N7O3
Molecular Weight: 475.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1cc(-c2ccnc(Nc3cnn(CCN4CCOCC4)c3)n2)ccc1OC1CCOCC1
Standard InChI: InChI=1S/C25H29N7O3/c26-16-20-15-19(1-2-24(20)35-22-4-11-33-12-5-22)23-3-6-27-25(30-23)29-21-17-28-32(18-21)8-7-31-9-13-34-14-10-31/h1-3,6,15,17-18,22H,4-5,7-14H2,(H,27,29,30)
Standard InChI Key: YVRJIQLODAYFSS-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
3.6380 -2.1004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5988 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3092 -5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6108 -5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 -5.2404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9020 -3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6004 -2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2978 3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2954 5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0048 6.0009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3026 5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6051 5.9945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9026 5.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2571 5.8543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2552 4.7345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.4986 3.4393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.0982 2.0662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2081 0.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8088 -0.5176 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9210 -1.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5241 -3.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0150 -3.2645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.9029 -2.0555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2998 -0.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0330 3.7586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3002 3.7488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 3 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 10 1 0
5 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 28 1 0
25 34 1 0
34 22 2 0
20 35 2 0
35 16 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.55Molecular Weight (Monoisotopic): 475.2332AlogP: 2.85#Rotatable Bonds: 8Polar Surface Area: 110.35Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.68CX Basic pKa: 6.60CX LogP: 2.09CX LogD: 2.02Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.53Np Likeness Score: -1.61
References 1. (2015) Benzonitrile derivatives as kinase inhibitors,