The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8969335, A40 ID: ALA3687181
PubChem CID: 71295235
Max Phase: Preclinical
Molecular Formula: C23H25N7O2
Molecular Weight: 431.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1cc(-c2ccnc(Nc3cnn(C4CCNC4)c3)n2)ccc1OC1CCOCC1
Standard InChI: InChI=1S/C23H25N7O2/c24-12-17-11-16(1-2-22(17)32-20-5-9-31-10-6-20)21-4-8-26-23(29-21)28-18-13-27-30(15-18)19-3-7-25-14-19/h1-2,4,8,11,13,15,19-20,25H,3,5-7,9-10,14H2,(H,26,28,29)
Standard InChI Key: CIBVSEISWWXHEO-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
3.6380 -2.1004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5988 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3092 -5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6108 -5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 -5.2404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9020 -3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6004 -2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2978 3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2954 5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0048 6.0009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3026 5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6051 5.9945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9026 5.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2571 5.8543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2552 4.7345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.4986 3.4393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0330 3.7586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1020 2.0652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5266 1.6549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5586 0.1552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1423 -0.3387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2349 0.8558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3002 3.7488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 3 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 10 1 0
5 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 22 2 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
20 32 2 0
32 16 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.50Molecular Weight (Monoisotopic): 431.2070AlogP: 3.05#Rotatable Bonds: 6Polar Surface Area: 109.91Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.94CX Basic pKa: 10.33CX LogP: 1.26CX LogD: -1.05Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.61Np Likeness Score: -1.16
References 1. (2015) Benzonitrile derivatives as kinase inhibitors,