The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8969335, A43 ID: ALA3687184
PubChem CID: 71295163
Max Phase: Preclinical
Molecular Formula: C24H24N8O2
Molecular Weight: 456.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1cc(-c2ccnc(Nc3cnn(CCn4cccn4)c3)n2)ccc1OC1CCOCC1
Standard InChI: InChI=1S/C24H24N8O2/c25-15-19-14-18(2-3-23(19)34-21-5-12-33-13-6-21)22-4-8-26-24(30-22)29-20-16-28-32(17-20)11-10-31-9-1-7-27-31/h1-4,7-9,14,16-17,21H,5-6,10-13H2,(H,26,29,30)
Standard InChI Key: HYKUTXSZGOOHPE-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
3.6380 -2.1004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5988 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3092 -5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6108 -5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 -5.2404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9020 -3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6004 -2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2978 3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2954 5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0048 6.0009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3026 5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6051 5.9945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9026 5.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2571 5.8543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2552 4.7345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.4986 3.4393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.0982 2.0662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2081 0.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8088 -0.5176 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.0434 -1.7928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0414 -2.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4148 -2.3095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2656 -0.8169 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0330 3.7586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3002 3.7488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 3 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 10 1 0
5 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 28 1 0
25 33 1 0
33 22 2 0
20 34 2 0
34 16 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.51Molecular Weight (Monoisotopic): 456.2022AlogP: 3.41#Rotatable Bonds: 8Polar Surface Area: 115.70Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.68CX Basic pKa: 2.25CX LogP: 2.52CX LogD: 2.52Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: -1.80
References 1. (2015) Benzonitrile derivatives as kinase inhibitors,