The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8969341, 84 ID: ALA3687307
PubChem CID: 89601405
Max Phase: Preclinical
Molecular Formula: C29H27Cl2N3O2
Molecular Weight: 520.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1-n1nc2c(c1C(C)C)C(c1ccc(Cl)cc1C)N(c1cc(Cl)ccc1C)C2=O
Standard InChI: InChI=1S/C29H27Cl2N3O2/c1-16(2)27-25-26(32-34(27)22-8-6-7-9-24(22)36-5)29(35)33(23-15-20(31)11-10-17(23)3)28(25)21-13-12-19(30)14-18(21)4/h6-16,28H,1-5H3
Standard InChI Key: ZPZFPPPXKLFRBC-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
5.0390 -0.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8395 -0.8809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1265 -2.2016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9144 -3.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2029 -4.7985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7035 -4.8426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9157 -3.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6321 -2.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4623 2.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2432 3.6715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9623 2.7008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4258 1.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8530 0.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0487 -0.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4362 -1.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6235 -0.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7335 -0.7880 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-6.4234 1.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0359 1.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8754 2.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6281 -2.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1385 -3.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8218 -2.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8444 3.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3210 3.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2915 4.7851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4721 4.5702 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.7863 6.1975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3105 6.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3400 5.3223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1593 5.5369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
19 21 1 0
21 22 2 0
22 16 1 0
22 23 1 0
15 24 1 0
24 11 1 0
24 25 2 0
25 9 1 0
25 26 1 0
26 27 1 0
26 28 1 0
14 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
31 33 2 0
33 34 1 0
34 35 2 0
35 29 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.46Molecular Weight (Monoisotopic): 519.1480AlogP: 7.68#Rotatable Bonds: 5Polar Surface Area: 47.36Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.45CX Basic pKa: ┄CX LogP: 8.10CX LogD: 8.10Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.27Np Likeness Score: -0.94
References 1. (2015) Pyrazolopyrrolidine compounds,