The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8969341, 85 ID: ALA3687308
PubChem CID: 89601371
Max Phase: Preclinical
Molecular Formula: C23H20Cl2FN3O2
Molecular Weight: 460.34
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(Cl)ccc1C1c2c(nn(CCO)c2C2CC2)C(=O)N1c1cccc(Cl)c1F
Standard InChI: InChI=1S/C23H20Cl2FN3O2/c1-12-11-14(24)7-8-15(12)22-18-20(27-28(9-10-30)21(18)13-5-6-13)23(31)29(22)17-4-2-3-16(25)19(17)26/h2-4,7-8,11,13,22,30H,5-6,9-10H2,1H3
Standard InChI Key: QRUJCXIVKXOPIJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
3.6954 -1.1450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1265 -2.2016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9144 -3.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2029 -4.7985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8332 -5.8197 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.7035 -4.8426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9157 -3.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6321 -2.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.4760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7115 0.3949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1750 -1.0317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6009 -1.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7148 -0.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.8568 -0.8543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9615 -1.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9612 -3.4141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -4.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1041 -4.5461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6408 0.8581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8369 2.3469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2246 2.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4117 1.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2111 0.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1608 -0.2206 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.8234 -0.0566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6626 -1.2457 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
4 6 2 0
6 7 1 0
7 8 2 0
8 2 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
15 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 20 1 0
19 23 2 0
23 9 1 0
23 13 1 0
10 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 1 0
28 30 2 0
30 24 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.34Molecular Weight (Monoisotopic): 459.0917AlogP: 5.26#Rotatable Bonds: 5Polar Surface Area: 58.36Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.44CX Basic pKa: ┄CX LogP: 5.08CX LogD: 5.08Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.57Np Likeness Score: -1.12
References 1. (2015) Pyrazolopyrrolidine compounds,