The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8703771, 3 ID: ALA3690074
PubChem CID: 46830970
Max Phase: Preclinical
Molecular Formula: C30H31N7O
Molecular Weight: 505.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)c2ccc3c(c2)CCC3N2CCNCC2)cc1Nc1nccc(-c2cccnc2)n1
Standard InChI: InChI=1S/C30H31N7O/c1-20-4-7-24(18-27(20)36-30-33-12-10-26(35-30)23-3-2-11-32-19-23)34-29(38)22-5-8-25-21(17-22)6-9-28(25)37-15-13-31-14-16-37/h2-5,7-8,10-12,17-19,28,31H,6,9,13-16H2,1H3,(H,34,38)(H,33,35,36)
Standard InChI Key: SZPKERXOPUWUPW-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
7.5307 -5.8571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1924 -6.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8934 -5.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1884 2.6408 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2738 3.8234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8433 5.2111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3298 5.4117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2468 4.2247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6773 2.8370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1925 -3.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -3.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7897 -3.0040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7876 -1.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0841 -0.7486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0789 0.7514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7773 1.4969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4808 0.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4860 -0.7576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1786 1.4883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1709 2.9884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8682 3.7318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5729 2.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5804 1.4753 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8832 0.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 2 0
7 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
16 17 2 0
17 9 1 0
13 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 18 1 0
5 24 1 0
24 25 2 0
25 2 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
31 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.63Molecular Weight (Monoisotopic): 505.2590AlogP: 4.74#Rotatable Bonds: 6Polar Surface Area: 95.07Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.69CX Basic pKa: 9.25CX LogP: 4.54CX LogD: 2.70Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.35Np Likeness Score: -1.32
References 1. (2014) Preparation method of dihydroindene amide compounds, their pharmaceutical compositions containing compounds thereof and use as protein kinases inhibitor,