The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8703771, 4 ID: ALA3690075
PubChem CID: 46830971
Max Phase: Preclinical
Molecular Formula: C32H35N7O
Molecular Weight: 533.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCN1CCN(C2CCc3cc(C(=O)Nc4ccc(C)c(Nc5nccc(-c6cccnc6)n5)c4)ccc32)CC1
Standard InChI: InChI=1S/C32H35N7O/c1-3-38-15-17-39(18-16-38)30-11-8-23-19-24(7-10-27(23)30)31(40)35-26-9-6-22(2)29(20-26)37-32-34-14-12-28(36-32)25-5-4-13-33-21-25/h4-7,9-10,12-14,19-21,30H,3,8,11,15-18H2,1-2H3,(H,35,40)(H,34,36,37)
Standard InChI Key: JVGNHFZOVWJKER-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
-5.1016 -6.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9504 -7.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8628 -6.1485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4233 -6.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3384 -5.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6928 -4.0817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1327 -3.6551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2175 -4.6910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0351 3.6026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6061 6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6061 7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3071 8.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3071 9.4503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0080 7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2933 8.2481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5920 7.4959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8936 8.2414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1901 7.4869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1849 5.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8833 5.2414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5869 5.9958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8782 3.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1735 2.9840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1659 1.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8632 0.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5679 1.4971 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5754 2.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0080 6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 3 1 0
6 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 9 1 0
17 12 1 0
14 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
32 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
26 40 2 0
40 21 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.68Molecular Weight (Monoisotopic): 533.2903AlogP: 5.47#Rotatable Bonds: 7Polar Surface Area: 86.28Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.69CX Basic pKa: 8.08CX LogP: 5.28CX LogD: 4.51Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.33Np Likeness Score: -1.49
References 1. (2014) Preparation method of dihydroindene amide compounds, their pharmaceutical compositions containing compounds thereof and use as protein kinases inhibitor,