US8703771, 15

ID: ALA3690083

PubChem CID: 58579022

Max Phase: Preclinical

Molecular Formula: C31H33N7O

Molecular Weight: 519.65

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)c2ccc3c(c2)CCC3N2CCN(C)CC2)cc1Nc1nccc(-c2ccncc2)n1

Standard InChI:  InChI=1S/C31H33N7O/c1-21-3-6-25(20-28(21)36-31-33-14-11-27(35-31)22-9-12-32-13-10-22)34-30(39)24-4-7-26-23(19-24)5-8-29(26)38-17-15-37(2)16-18-38/h3-4,6-7,9-14,19-20,29H,5,8,15-18H2,1-2H3,(H,34,39)(H,33,35,36)

Standard InChI Key:  GMYQHOQOEQWZGN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   -3.7307   -6.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8628   -6.1485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4233   -6.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3384   -5.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6928   -4.0817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1327   -3.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2175   -4.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0351    3.6026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039    3.7494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070    5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6061    6.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6061    7.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3071    8.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3071    9.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0080    7.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2933    8.2481    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5920    7.4959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8936    8.2414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1901    7.4869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1849    5.9869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8833    5.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5869    5.9958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8782    3.7406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1735    2.9840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1659    1.4840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8632    0.7406    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5679    1.4971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5754    2.9971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0080    6.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  2  1  0
  5  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16  8  1  0
 16 11  1  0
 13 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 31 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 25 39  2  0
 39 20  1  0
M  END

Associated Targets(Human)

PDGFRB Tclin Platelet-derived growth factor receptor beta (5195 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABL1 Tclin Tyrosine-protein kinase ABL (18331 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KIT Tclin Stem cell growth factor receptor (10667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 519.65Molecular Weight (Monoisotopic): 519.2747AlogP: 5.08#Rotatable Bonds: 6
Polar Surface Area: 86.28Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.72CX Basic pKa: 7.98CX LogP: 4.92CX LogD: 4.24
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.37Np Likeness Score: -1.30

References

1.  (2014)  Preparation method of dihydroindene amide compounds, their pharmaceutical compositions containing compounds thereof and use as protein kinases inhibitor, 

Source

Source(1):