The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8703771, 15 ID: ALA3690083
PubChem CID: 58579022
Max Phase: Preclinical
Molecular Formula: C31H33N7O
Molecular Weight: 519.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)c2ccc3c(c2)CCC3N2CCN(C)CC2)cc1Nc1nccc(-c2ccncc2)n1
Standard InChI: InChI=1S/C31H33N7O/c1-21-3-6-25(20-28(21)36-31-33-14-11-27(35-31)22-9-12-32-13-10-22)34-30(39)24-4-7-26-23(19-24)5-8-29(26)38-17-15-37(2)16-18-38/h3-4,6-7,9-14,19-20,29H,5,8,15-18H2,1-2H3,(H,34,39)(H,33,35,36)
Standard InChI Key: GMYQHOQOEQWZGN-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
-3.7307 -6.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8628 -6.1485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4233 -6.5700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3384 -5.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6928 -4.0817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1327 -3.6551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2175 -4.6910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0351 3.6026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6061 6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6061 7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3071 8.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3071 9.4503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0080 7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2933 8.2481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5920 7.4959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8936 8.2414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1901 7.4869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1849 5.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8833 5.2414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5869 5.9958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8782 3.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1735 2.9840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1659 1.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8632 0.7406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5679 1.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5754 2.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0080 6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 2 1 0
5 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 8 1 0
16 11 1 0
13 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
31 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
25 39 2 0
39 20 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.65Molecular Weight (Monoisotopic): 519.2747AlogP: 5.08#Rotatable Bonds: 6Polar Surface Area: 86.28Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.72CX Basic pKa: 7.98CX LogP: 4.92CX LogD: 4.24Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.37Np Likeness Score: -1.30
References 1. (2014) Preparation method of dihydroindene amide compounds, their pharmaceutical compositions containing compounds thereof and use as protein kinases inhibitor,