US8703811, 10

ID: ALA3690109

PubChem CID: 44480860

Max Phase: Preclinical

Molecular Formula: C13H21N3OS

Molecular Weight: 267.40

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCNC(=O)c1ccc(N2CCN(C)CC2)s1

Standard InChI:  InChI=1S/C13H21N3OS/c1-3-6-14-13(17)11-4-5-12(18-11)16-9-7-15(2)8-10-16/h4-5H,3,6-10H2,1-2H3,(H,14,17)

Standard InChI Key:  JAWCIYWVQKUFOY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 18 19  0  0  0  0  0  0  0  0999 V2000
    4.1232   -9.5610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6391   -8.4629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5250   -7.2514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9195   -5.8781    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8054   -4.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9984   -4.7960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2010   -3.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9531   -1.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9511   -0.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7343   -2.9815    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 18 12  1  0
M  END

Associated Targets(Human)

DHODH Tclin Dihydroorotate dehydrogenase (2737 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

dhod Dihydroorotate dehydrogenase (710 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 267.40Molecular Weight (Monoisotopic): 267.1405AlogP: 1.64#Rotatable Bonds: 4
Polar Surface Area: 35.58Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.23CX LogP: 1.96CX LogD: 1.74
Aromatic Rings: 1Heavy Atoms: 18QED Weighted: 0.90Np Likeness Score: -1.82

References

1.  (2014)  Small molecule inhibitors of Plasmodium falciparum dihydroorotate dehydrogenase, 

Source

Source(1):