The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8969341, 118 ID: ALA3691714
PubChem CID: 89601791
Max Phase: Preclinical
Molecular Formula: C27H24Cl2N4O2
Molecular Weight: 507.42
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1-n1nc2c(c1C(C)C)C(c1ccc(Cl)cc1C)N(c1ccnc(Cl)c1)C2=O
Standard InChI: InChI=1S/C27H24Cl2N4O2/c1-15(2)25-23-24(31-33(25)20-7-5-6-8-21(20)35-4)27(34)32(18-11-12-30-22(29)14-18)26(23)19-10-9-17(28)13-16(19)3/h5-15,26H,1-4H3
Standard InChI Key: LQFQEWGXGDBOGP-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
5.0390 -0.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8395 -0.8809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1265 -2.2016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9144 -3.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2029 -4.7985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7035 -4.8426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9157 -3.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6321 -2.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4623 2.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2432 3.6715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9623 2.7008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4258 1.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8530 0.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0487 -0.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4362 -1.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.6235 -0.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7335 -0.7880 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-6.4234 1.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0359 1.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8754 2.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6281 -2.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1385 -3.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8218 -2.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8444 3.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3400 5.3223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3105 6.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7863 6.1975 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2915 4.7851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4721 4.5702 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.3210 3.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
19 21 1 0
21 22 2 0
22 16 1 0
22 23 1 0
15 24 1 0
24 11 1 0
24 25 2 0
25 9 1 0
25 26 1 0
26 27 1 0
26 28 1 0
14 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 1 0
33 35 2 0
35 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.42Molecular Weight (Monoisotopic): 506.1276AlogP: 6.76#Rotatable Bonds: 5Polar Surface Area: 60.25Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.42CX Basic pKa: 0.59CX LogP: 6.59CX LogD: 6.59Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.28Np Likeness Score: -1.14
References 1. (2015) Pyrazolopyrrolidine compounds,