US8969341, 139

ID: ALA3691735

PubChem CID: 89601620

Max Phase: Preclinical

Molecular Formula: C23H22Cl2FN3O2

Molecular Weight: 462.35

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(Cl)ccc1[C@H]1c2c(nn(CCO)c2C(C)C)C(=O)N1c1cccc(Cl)c1F

Standard InChI:  InChI=1S/C23H22Cl2FN3O2/c1-12(2)21-18-20(27-28(21)9-10-30)23(31)29(17-6-4-5-16(25)19(17)26)22(18)15-8-7-14(24)11-13(15)3/h4-8,11-12,22,30H,9-10H2,1-3H3/t22-/m0/s1

Standard InChI Key:  HMHZLUVFZNQBTE-QFIPXVFZSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  1  0  0  0  0  0999 V2000
    1.1385   -3.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6281   -2.2462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8218   -2.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4258    1.2743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9623    2.7009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4623    2.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2433    3.6715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2135    0.3943    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.0323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6332   -2.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1255   -2.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8329   -3.0529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8444    3.9150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1279    5.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9158    6.5112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4151    6.4671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1266    5.1466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3261    5.1113    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.3387    3.8702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9076    2.8136    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8530    0.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0487   -0.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4362   -1.2486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6235   -0.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7335   -0.7879    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.4234    1.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0359    1.7245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8754    2.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10  5  1  0
 10 11  2  0
 11 12  1  0
 12  4  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
  7 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 22 16  1  0
 22 23  1  0
  6 24  1  1
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 27 29  1  0
 29 30  2  0
 30 24  1  0
 30 31  1  0
M  END

Associated Targets(Human)

MDM4 Tchem Protein Mdm4 (729 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDM2 Tchem p53-binding protein Mdm-2 (4545 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.35Molecular Weight (Monoisotopic): 461.1073AlogP: 5.50#Rotatable Bonds: 5
Polar Surface Area: 58.36Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.45CX Basic pKa: CX LogP: 5.54CX LogD: 5.54
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -1.19

References

1.  (2015)  Pyrazolopyrrolidine compounds, 

Source

Source(1):