US8969341, 144

ID: ALA3691740

PubChem CID: 89602035

Max Phase: Preclinical

Molecular Formula: C32H34Cl2N4O3

Molecular Weight: 593.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1-n1nc2c(c1C(C)C)[C@@H](c1ccc(Cl)cc1C)N(c1cc(Cl)ccc1OCCN(C)C)C2=O

Standard InChI:  InChI=1S/C32H34Cl2N4O3/c1-19(2)30-28-29(35-38(30)24-9-7-8-10-26(24)40-6)32(39)37(31(28)23-13-11-21(33)17-20(23)3)25-18-22(34)12-14-27(25)41-16-15-36(4)5/h7-14,17-19,31H,15-16H2,1-6H3/t31-/m1/s1

Standard InChI Key:  YBMQYNARIZUNIO-WJOKGBTCSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  1  0  0  0  0  0999 V2000
    5.0390   -0.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8395   -0.8809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1265   -2.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9144   -3.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2029   -4.7985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7035   -4.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9157   -3.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6321   -2.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.0323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2135    0.3943    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4623    2.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2432    3.6715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9623    2.7008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4258    1.2743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8530    0.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8869    1.8994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3443    1.5444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7655    0.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9315   -0.1792    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -5.7294   -0.9799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2720   -0.6249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4429   -1.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6281   -2.2462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1385   -3.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8218   -2.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8444    3.9150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3210    3.6414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2915    4.7851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4721    4.5702    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -4.7863    6.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3105    6.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3400    5.3223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8636    5.5924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3584    7.0056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1179    7.2756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6232    8.6888    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8036    8.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8463    9.6034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  1
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 19 21  1  0
 21 22  2  0
 22 16  1  0
 22 23  1  0
 15 24  1  0
 24 11  1  0
 24 25  2  0
 25  9  1  0
 25 26  1  0
 26 27  1  0
 26 28  1  0
 14 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 33 34  1  0
 34 35  2  0
 35 29  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 39 41  1  0
M  END

Associated Targets(Human)

MDM4 Tchem Protein Mdm4 (729 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDM2 Tchem p53-binding protein Mdm-2 (4545 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 593.55Molecular Weight (Monoisotopic): 592.2008AlogP: 7.31#Rotatable Bonds: 9
Polar Surface Area: 59.83Molecular Species: BASEHBA: 6HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.38CX Basic pKa: 8.70CX LogP: 7.45CX LogD: 6.13
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.20Np Likeness Score: -0.99

References

1.  (2015)  Pyrazolopyrrolidine compounds, 

Source

Source(1):