The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8969348, [4-(Naphthalen-1-ylmethyl)-1-oxophthalazin-2(1H)-yl](phenyl)acetic acid ID: ALA3691800
PubChem CID: 46175946
Max Phase: Preclinical
Molecular Formula: C27H20N2O3
Molecular Weight: 420.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)C(c1ccccc1)n1nc(Cc2cccc3ccccc23)c2ccccc2c1=O
Standard InChI: InChI=1S/C27H20N2O3/c30-26-23-16-7-6-15-22(23)24(17-20-13-8-12-18-9-4-5-14-21(18)20)28-29(26)25(27(31)32)19-10-2-1-3-11-19/h1-16,25H,17H2,(H,31,32)
Standard InChI Key: VEJXCOIVBQLOOM-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
1.5689 -3.6022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6060 -2.9986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6472 -3.5953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6004 2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9020 3.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9072 5.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6108 5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6159 7.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3195 8.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0179 7.5039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0127 6.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3092 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2007 -1.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4972 -0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4920 0.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1903 1.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8939 0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 9 1 0
18 13 1 0
7 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
24 25 1 0
25 5 1 0
25 26 2 0
4 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.47Molecular Weight (Monoisotopic): 420.1474AlogP: 4.81#Rotatable Bonds: 5Polar Surface Area: 72.19Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.57CX Basic pKa: ┄CX LogP: 5.30CX LogD: 1.95Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -0.71
References 1. (2015) Chymase inhibitors,