US8969348, [4-(Naphthalen-1-ylmethyl)-1-oxophthalazin-2(1H)-yl](phenyl)acetic acid

ID: ALA3691800

PubChem CID: 46175946

Max Phase: Preclinical

Molecular Formula: C27H20N2O3

Molecular Weight: 420.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)C(c1ccccc1)n1nc(Cc2cccc3ccccc23)c2ccccc2c1=O

Standard InChI:  InChI=1S/C27H20N2O3/c30-26-23-16-7-6-15-22(23)24(17-20-13-8-12-18-9-4-5-14-21(18)20)28-29(26)25(27(31)32)19-10-2-1-3-11-19/h1-16,25H,17H2,(H,31,32)

Standard InChI Key:  VEJXCOIVBQLOOM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    1.5689   -3.6022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6060   -2.9986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6472   -3.5953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039    3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6004    2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9020    3.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9072    5.2405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6108    5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6159    7.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3195    8.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0179    7.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0127    6.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3092    5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2007   -1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4972   -0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4920    0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1903    1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8939    0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18  9  1  0
 18 13  1  0
  7 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 24 25  1  0
 25  5  1  0
 25 26  2  0
  4 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Associated Targets(Human)

CMA1 Tchem Chymase (726 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.47Molecular Weight (Monoisotopic): 420.1474AlogP: 4.81#Rotatable Bonds: 5
Polar Surface Area: 72.19Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.57CX Basic pKa: CX LogP: 5.30CX LogD: 1.95
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -0.71

References

1.  (2015)  Chymase inhibitors, 

Source

Source(1):