The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8969348, {4-[(1,4-Dimethyl-1H-indol-3-yl)methyl]-1-oxophthalazin-2(1H)-yl}(phenyl)acetic acid ID: ALA3691804
PubChem CID: 44626375
Max Phase: Preclinical
Molecular Formula: C27H23N3O3
Molecular Weight: 437.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc2c1c(Cc1nn(C(C(=O)O)c3ccccc3)c(=O)c3ccccc13)cn2C
Standard InChI: InChI=1S/C27H23N3O3/c1-17-9-8-14-23-24(17)19(16-29(23)2)15-22-20-12-6-7-13-21(20)26(31)30(28-22)25(27(32)33)18-10-4-3-5-11-18/h3-14,16,25H,15H2,1-2H3,(H,32,33)
Standard InChI Key: UAYYAAIBVQDTIU-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
4.9201 -3.6809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7201 -2.7865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1884 -3.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1884 -1.9754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7201 -0.5504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2519 -0.2434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2519 -1.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2938 3.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2900 4.9562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3351 3.1598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3092 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6108 5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9072 5.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9020 3.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6004 2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0320 0.7358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4982 1.0526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9827 2.1504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
13 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
12 23 1 0
23 24 2 0
23 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 10 1 0
30 25 1 0
8 31 2 0
31 32 1 0
32 6 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 437.50Molecular Weight (Monoisotopic): 437.1739AlogP: 4.46#Rotatable Bonds: 5Polar Surface Area: 77.12Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.43CX Basic pKa: ┄CX LogP: 5.14CX LogD: 1.75Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.44Np Likeness Score: -0.71
References 1. (2015) Chymase inhibitors,