US9056843, 70

ID: ALA3692606

PubChem CID: 71230903

Max Phase: Preclinical

Molecular Formula: C16H11F3N4O2

Molecular Weight: 348.28

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(NC(=O)c2ccc(-c3noc(C(F)(F)F)n3)cc2)ccn1

Standard InChI:  InChI=1S/C16H11F3N4O2/c1-9-8-12(6-7-20-9)21-14(24)11-4-2-10(3-5-11)13-22-15(25-23-13)16(17,18)19/h2-8H,1H3,(H,20,21,24)

Standard InChI Key:  KNTZPJOJMGCEPU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031    3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039    3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3421    3.1476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070    5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6061    6.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6061    7.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3071    8.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0080    7.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0080    6.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3071    9.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5193   10.6128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0536   12.0387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5536   12.0363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0923   10.6090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3290   13.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1567   14.3444    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.5221   13.1194    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.0363   14.2164    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 11 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
 17 19  1  0
 19 20  1  0
 19 21  1  0
 19 22  1  0
  4 23  2  0
 23 24  1  0
 24 25  2  0
 25  2  1  0
M  END

Associated Targets(Human)

HDAC4 Tclin Histone deacetylase 4 (2328 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 348.28Molecular Weight (Monoisotopic): 348.0834AlogP: 3.71#Rotatable Bonds: 3
Polar Surface Area: 80.91Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.36CX LogP: 3.45CX LogD: 3.41
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.78Np Likeness Score: -1.90

References

1.  (2015)  Trifluoromethyl-oxadiazole derivatives and their use in the treatment of disease, 

Source

Source(1):