US9056843, 106

ID: ALA3692640

PubChem CID: 71230784

Max Phase: Preclinical

Molecular Formula: C15H9F4N3O3S

Molecular Weight: 387.31

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(Nc1cccc(F)c1)c1ccc(-c2noc(C(F)(F)F)n2)cc1

Standard InChI:  InChI=1S/C15H9F4N3O3S/c16-10-2-1-3-11(8-10)22-26(23,24)12-6-4-9(5-7-12)13-20-14(25-21-13)15(17,18)19/h1-8,22H

Standard InChI Key:  VJECNJFLZGGHEX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5972   -1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5951   -3.0039    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5548   -3.6021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5568   -2.4023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8902   -5.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1877   -6.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4883   -5.2624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4914   -3.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1939   -3.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7864   -6.0154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9236   -7.4964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.3907   -7.8089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1413   -6.5102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1381   -5.3950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6314   -6.3543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.3369   -7.3250    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -12.1197   -5.2581    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -12.8248   -6.2289    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  2  0
  8 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 17  1  0
 20 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
  6 26  2  0
 26  2  1  0
M  END

Associated Targets(Human)

HDAC4 Tclin Histone deacetylase 4 (2328 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 387.31Molecular Weight (Monoisotopic): 387.0301AlogP: 3.70#Rotatable Bonds: 4
Polar Surface Area: 85.09Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.41CX Basic pKa: CX LogP: 4.13CX LogD: 3.87
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.69Np Likeness Score: -2.21

References

1.  (2015)  Trifluoromethyl-oxadiazole derivatives and their use in the treatment of disease, 

Source

Source(1):