US9056843, 133

ID: ALA3692667

PubChem CID: 71230717

Max Phase: Preclinical

Molecular Formula: C17H21F3N4O2

Molecular Weight: 370.38

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)C[C@H](C)NC(=O)c1ccc(-c2noc(C(F)(F)F)n2)cc1

Standard InChI:  InChI=1S/C17H21F3N4O2/c1-4-24(5-2)10-11(3)21-15(25)13-8-6-12(7-9-13)14-22-16(26-23-14)17(18,19)20/h6-9,11H,4-5,10H2,1-3H3,(H,21,25)/t11-/m0/s1

Standard InChI Key:  BWCIUZLJTVXSMW-NSHDSACASA-N

Molfile:  

     RDKit          2D

 26 27  0  0  1  0  0  0  0  0999 V2000
    6.2253   -8.1139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1873   -7.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1894   -6.0109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4889   -5.2601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4893   -4.0601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9336   -3.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7390    2.9810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2067    3.2905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9546    1.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9492    0.8772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4444    1.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1519    2.8006    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9304    0.7342    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6376    1.7034    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  3  6  1  0
  6  7  1  0
  7  8  1  1
  7  9  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 18  1  0
 21 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
M  END

Associated Targets(Human)

HDAC4 Tclin Histone deacetylase 4 (2328 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 370.38Molecular Weight (Monoisotopic): 370.1617AlogP: 3.22#Rotatable Bonds: 7
Polar Surface Area: 71.26Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.27CX LogP: 3.55CX LogD: 1.67
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.81Np Likeness Score: -1.78

References

1.  (2015)  Trifluoromethyl-oxadiazole derivatives and their use in the treatment of disease, 

Source

Source(1):