US9056843, 140

ID: ALA3692674

PubChem CID: 71230843

Max Phase: Preclinical

Molecular Formula: C16H18F4N4O2

Molecular Weight: 374.34

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(C)C[C@@H](C)NC(=O)c1ccc(-c2noc(C(F)(F)F)n2)cc1F

Standard InChI:  InChI=1S/C16H18F4N4O2/c1-4-24(3)8-9(2)21-14(25)11-6-5-10(7-12(11)17)13-22-15(26-23-13)16(18,19)20/h5-7,9H,4,8H2,1-3H3,(H,21,25)/t9-/m1/s1

Standard InChI Key:  NSBYDCURMKSEIJ-SECBINFHSA-N

Molfile:  

     RDKit          2D

 26 27  0  0  1  0  0  0  0  0999 V2000
   10.1394   -1.3343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0990   -0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8003   -1.4887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8024   -2.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4990   -0.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2024   -2.6932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6024   -2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7390    2.9810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2067    3.2905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9546    1.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9492    0.8772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4444    1.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1519    2.8006    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9304    0.7342    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6376    1.7034    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  3  5  1  0
  5  6  1  0
  6  7  1  1
  6  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 16 17  1  0
 14 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 18  1  0
 21 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
M  END

Associated Targets(Human)

HDAC4 Tclin Histone deacetylase 4 (2328 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 374.34Molecular Weight (Monoisotopic): 374.1366AlogP: 2.96#Rotatable Bonds: 6
Polar Surface Area: 71.26Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.73CX Basic pKa: 9.00CX LogP: 3.34CX LogD: 1.74
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.79Np Likeness Score: -2.13

References

1.  (2015)  Trifluoromethyl-oxadiazole derivatives and their use in the treatment of disease, 

Source

Source(1):