The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9067937, 94 ID: ALA3692820
Max Phase: Preclinical
Molecular Formula: C25H28Cl2N4O2
Molecular Weight: 487.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1cnc2ccc(-c3cc(Cl)c(O)c(Cl)c3)nc2c1N[C@H]1CC[C@@H](CN(C)C)CC1
Standard InChI: InChI=1S/C25H28Cl2N4O2/c1-14(32)18-12-28-22-9-8-21(16-10-19(26)25(33)20(27)11-16)30-24(22)23(18)29-17-6-4-15(5-7-17)13-31(2)3/h8-12,15,17,33H,4-7,13H2,1-3H3,(H,28,29)/t15-,17+
Standard InChI Key: DKZYXHCYPUVGAF-WOVMCDHWSA-N
Molfile:
RDKit 2D
33 36 0 0 1 0 0 0 0 0999 V2000
10.1303 1.3695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0920 0.7680 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0940 -0.4320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7907 1.5158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4920 0.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1903 1.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8939 0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2007 -1.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4972 -0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5969 -6.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5945 -7.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6327 -8.1046 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.2942 -8.2509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2923 -9.4509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0036 -7.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0438 -8.0971 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.0012 -5.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5955 2.7031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 0.9049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
5 4 1 1
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 5 1 0
8 11 1 1
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 12 1 0
21 16 1 0
19 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
24 26 2 0
26 27 1 0
26 28 1 0
28 29 1 0
28 30 2 0
30 22 1 0
13 31 1 0
31 32 2 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.43Molecular Weight (Monoisotopic): 486.1589AlogP: 6.04#Rotatable Bonds: 6Polar Surface Area: 78.35Molecular Species: ZWITTERIONHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.12CX Basic pKa: 9.29CX LogP: 4.06CX LogD: 4.06Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -0.97
References 1. (2015) 1,5-naphthyridine derivatives and MELK inhibitors containing the same,