US9067937, 96

ID: ALA3692822

PubChem CID: 136266700

Max Phase: Preclinical

Molecular Formula: C26H24ClFN6O2

Molecular Weight: 506.97

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)c1cnc2ccc(-c3cc(F)c(O)c(Cl)c3)nc2c1Nc1ccc(N2CCC[C@@H](N)C2)nc1

Standard InChI:  InChI=1S/C26H24ClFN6O2/c1-14(35)18-12-30-22-6-5-21(15-9-19(27)26(36)20(28)10-15)33-25(22)24(18)32-17-4-7-23(31-11-17)34-8-2-3-16(29)13-34/h4-7,9-12,16,36H,2-3,8,13,29H2,1H3,(H,30,32)/t16-/m1/s1

Standard InChI Key:  DJTWSDDNMRSYIX-MRXNPFEDSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  1  0  0  0  0  0999 V2000
    2.6024   -2.6977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6387   -0.8963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031   -3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3092   -5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6108   -5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9073   -5.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9021   -3.7404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6004   -2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2095   -5.9863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2172   -7.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5200   -8.2298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8153   -7.4732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8077   -5.9732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8439   -5.3680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5049   -5.2298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1968   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4971   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7950   -1.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8352   -0.9063    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7926   -3.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8309   -3.6063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4923   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4904   -4.9525    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -5.1945   -3.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  7  1  0
 12 13  2  0
 13  4  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  6
 25 27  1  0
 27 21  1  0
 10 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 30 32  2  0
 32 33  1  0
 32 34  1  0
 34 35  1  0
 34 36  2  0
 36 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3692822

    ---

Associated Targets(Human)

MELK Tchem Maternal embryonic leucine zipper kinase (3491 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.97Molecular Weight (Monoisotopic): 506.1633AlogP: 5.06#Rotatable Bonds: 5
Polar Surface Area: 117.26Molecular Species: BASEHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.67CX Basic pKa: 9.87CX LogP: 4.43CX LogD: 4.38
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.32Np Likeness Score: -1.52

References

1.  (2015)  1,5-naphthyridine derivatives and MELK inhibitors containing the same, 

Source

Source(1):