US9067937, 201

ID: ALA3692823

PubChem CID: 136266699

Max Phase: Preclinical

Molecular Formula: C28H26Cl2N6O2

Molecular Weight: 549.46

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N[C@@H]1CCCN(c2ccc(Nc3c(C(=O)C4CC4)cnc4ccc(-c5cc(Cl)c(O)c(Cl)c5)nc34)cn2)C1

Standard InChI:  InChI=1S/C28H26Cl2N6O2/c29-20-10-16(11-21(30)28(20)38)22-6-7-23-26(35-22)25(19(13-32-23)27(37)15-3-4-15)34-18-5-8-24(33-12-18)36-9-1-2-17(31)14-36/h5-8,10-13,15,17,38H,1-4,9,14,31H2,(H,32,34)/t17-/m1/s1

Standard InChI Key:  NHIOHZSWBYQOAB-QGZVFWFLSA-N

Molfile:  

     RDKit          2D

 38 43  0  0  1  0  0  0  0  0999 V2000
    9.0708    4.9750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0768    3.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3796    3.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3872    1.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0920    0.7751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7891    1.5184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7816    3.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4920    0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4972   -0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2007   -1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -5.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5969   -6.0029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5945   -7.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6327   -8.1046    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.2942   -8.2509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2923   -9.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0036   -7.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0438   -8.0971    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.0012   -5.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5972    1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375    0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951    3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3408    4.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8408    4.2089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8939    0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1903    1.5091    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  2  1  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 13  1  0
 22 17  1  0
 20 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  2  0
 31 23  1  0
 14 32  1  0
 32 33  2  0
 32 34  1  0
 34 35  1  0
 35 36  1  0
 36 34  1  0
 11 37  1  0
 37 38  2  0
 38  8  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3692823

    ---

Associated Targets(Human)

MELK Tchem Maternal embryonic leucine zipper kinase (3491 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 549.46Molecular Weight (Monoisotopic): 548.1494AlogP: 5.97#Rotatable Bonds: 6
Polar Surface Area: 117.26Molecular Species: ZWITTERIONHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.13CX Basic pKa: 9.87CX LogP: 5.65CX LogD: 5.64
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -1.33

References

1.  (2015)  1,5-naphthyridine derivatives and MELK inhibitors containing the same, 

Source

Source(1):