US9067937, 203

ID: ALA3692825

PubChem CID: 136266697

Max Phase: Preclinical

Molecular Formula: C24H26Cl2N4O3

Molecular Weight: 489.40

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)[C@H]1CC[C@H](Nc2c(C(=O)CO)cnc3ccc(-c4cc(Cl)c(O)c(Cl)c4)nc23)CC1

Standard InChI:  InChI=1S/C24H26Cl2N4O3/c1-30(2)15-5-3-14(4-6-15)28-22-16(21(32)12-31)11-27-20-8-7-19(29-23(20)22)13-9-17(25)24(33)18(26)10-13/h7-11,14-15,31,33H,3-6,12H2,1-2H3,(H,27,28)/t14-,15-

Standard InChI Key:  HPFAWTWSLSXCBD-SHTZXODSSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  1  0  0  0  0  0999 V2000
    8.8311    0.9179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7907    1.5158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7886    2.7158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4920    0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1903    1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8939    0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2007   -1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4972   -0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -5.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5969   -6.0029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5945   -7.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6327   -8.1046    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.2942   -8.2509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2923   -9.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0036   -7.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0438   -8.0971    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.0012   -5.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5972    1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375    0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951    3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6331    3.6061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  2  1  1
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  4  1  0
  7 10  1  6
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 11  1  0
 20 15  1  0
 18 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 27 29  2  0
 29 21  1  0
 12 30  1  0
 30 31  2  0
 30 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3692825

    ---

Associated Targets(Human)

MELK Tchem Maternal embryonic leucine zipper kinase (3491 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 489.40Molecular Weight (Monoisotopic): 488.1382AlogP: 4.77#Rotatable Bonds: 6
Polar Surface Area: 98.58Molecular Species: ZWITTERIONHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 6.12CX Basic pKa: 9.51CX LogP: 2.94CX LogD: 2.93
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: -0.82

References

1.  (2015)  1,5-naphthyridine derivatives and MELK inhibitors containing the same, 

Source

Source(1):