The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9067937, 207 ID: ALA3692829
PubChem CID: 136981859
Max Phase: Preclinical
Molecular Formula: C27H26Cl2N6O2
Molecular Weight: 537.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)c1cnc2ccc(-c3cc(Cl)c(O)c(Cl)c3)nc2c1Nc1ccc(N2CCC[C@H](N)C2)nc1
Standard InChI: InChI=1S/C27H26Cl2N6O2/c1-2-23(36)18-13-31-22-7-6-21(15-10-19(28)27(37)20(29)11-15)34-26(22)25(18)33-17-5-8-24(32-12-17)35-9-3-4-16(30)14-35/h5-8,10-13,16,37H,2-4,9,14,30H2,1H3,(H,31,33)/t16-/m0/s1
Standard InChI Key: FZVUREXLVKVQEX-INIZCTEOSA-N
Molfile:
RDKit 2D
37 41 0 0 1 0 0 0 0 0999 V2000
4.9395 -1.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6024 -2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3092 -5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6108 -5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9073 -5.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9021 -3.7404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6004 -2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2095 -5.9863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2172 -7.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5200 -8.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8153 -7.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8077 -5.9732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8439 -5.3680 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5049 -5.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1968 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4971 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7950 -1.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8352 -0.9063 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-7.7926 -3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8309 -3.6063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4923 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4904 -4.9525 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.1945 -3.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 8 1 0
13 14 2 0
14 5 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 1
26 28 1 0
28 22 1 0
11 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
31 33 2 0
33 34 1 0
33 35 1 0
35 36 1 0
35 37 2 0
37 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.45Molecular Weight (Monoisotopic): 536.1494AlogP: 5.97#Rotatable Bonds: 6Polar Surface Area: 117.26Molecular Species: ZWITTERIONHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.13CX Basic pKa: 9.87CX LogP: 5.57CX LogD: 5.56Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -1.29
References 1. (2015) 1,5-naphthyridine derivatives and MELK inhibitors containing the same,