US9067937, 214

ID: ALA3692836

PubChem CID: 136981853

Max Phase: Preclinical

Molecular Formula: C27H26Cl2N6O2

Molecular Weight: 537.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(=O)c1cnc2ccc(-c3cc(Cl)c(O)c(Cl)c3)nc2c1Nc1ccc(N2CCC[C@@H](N)C2)nc1

Standard InChI:  InChI=1S/C27H26Cl2N6O2/c1-2-23(36)18-13-31-22-7-6-21(15-10-19(28)27(37)20(29)11-15)34-26(22)25(18)33-17-5-8-24(32-12-17)35-9-3-4-16(30)14-35/h5-8,10-13,16,37H,2-4,9,14,30H2,1H3,(H,31,33)/t16-/m1/s1

Standard InChI Key:  FZVUREXLVKVQEX-MRXNPFEDSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  1  0  0  0  0  0999 V2000
    4.9395   -1.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6024   -2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031   -3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3092   -5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6108   -5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9073   -5.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9021   -3.7404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6004   -2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2095   -5.9863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2172   -7.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5200   -8.2298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8153   -7.4732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8077   -5.9732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8439   -5.3680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5049   -5.2298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1968   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4971   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7950   -1.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8352   -0.9063    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -7.7926   -3.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8309   -3.6063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4923   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4904   -4.9525    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -5.1945   -3.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  3  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  8  1  0
 13 14  2  0
 14  5  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  6
 26 28  1  0
 28 22  1  0
 11 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 35 37  2  0
 37 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3692836

    ---

Associated Targets(Human)

MELK Tchem Maternal embryonic leucine zipper kinase (3491 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 537.45Molecular Weight (Monoisotopic): 536.1494AlogP: 5.97#Rotatable Bonds: 6
Polar Surface Area: 117.26Molecular Species: ZWITTERIONHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.13CX Basic pKa: 9.87CX LogP: 5.57CX LogD: 5.56
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -1.29

References

1.  (2015)  1,5-naphthyridine derivatives and MELK inhibitors containing the same, 

Source

Source(1):