US9067937, 216

ID: ALA3692838

PubChem CID: 136266761

Max Phase: Preclinical

Molecular Formula: C27H32Cl2N4O2

Molecular Weight: 515.49

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C(=O)c1cnc2ccc(-c3cc(Cl)c(O)c(Cl)c3)nc2c1N[C@H]1CC[C@H](CN(C)C)CC1

Standard InChI:  InChI=1S/C27H32Cl2N4O2/c1-15(2)26(34)19-13-30-23-10-9-22(17-11-20(28)27(35)21(29)12-17)32-25(23)24(19)31-18-7-5-16(6-8-18)14-33(3)4/h9-13,15-16,18,35H,5-8,14H2,1-4H3,(H,30,31)/t16-,18-

Standard InChI Key:  ORLZUJSQQRLTIA-SAABIXHNSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  1  0  0  0  0  0999 V2000
    4.9395   -1.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8969    0.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6024   -2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031   -3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3092   -5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6108   -5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9073   -5.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2081   -5.9890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2111   -7.4898    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2512   -8.0884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1729   -8.0916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9021   -3.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6004   -2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1968   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4971   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7950   -1.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8352   -0.9063    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -7.7926   -3.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8309   -3.6063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4923   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4904   -4.9525    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -5.1945   -3.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14  9  1  0
 14 15  2  0
 15  6  1  0
 15 16  1  0
 17 16  1  1
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  6
 21 22  1  0
 22 23  1  0
 22 24  1  0
 20 25  1  0
 25 26  1  0
 26 17  1  0
 12 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 33 35  2  0
 35 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3692838

    ---

Associated Targets(Human)

MELK Tchem Maternal embryonic leucine zipper kinase (3491 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 515.49Molecular Weight (Monoisotopic): 514.1902AlogP: 6.68#Rotatable Bonds: 7
Polar Surface Area: 78.35Molecular Species: ZWITTERIONHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.12CX Basic pKa: 9.29CX LogP: 5.31CX LogD: 5.30
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -0.84

References

1.  (2015)  1,5-naphthyridine derivatives and MELK inhibitors containing the same, 

Source

Source(1):