The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9067937, 217 ID: ALA3692839
PubChem CID: 136266758
Max Phase: Preclinical
Molecular Formula: C27H32ClFN4O2
Molecular Weight: 499.03
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C(=O)c1cnc2ccc(-c3cc(F)c(O)c(Cl)c3)nc2c1N[C@H]1CC[C@H](CN(C)C)CC1
Standard InChI: InChI=1S/C27H32ClFN4O2/c1-15(2)26(34)19-13-30-23-10-9-22(17-11-20(28)27(35)21(29)12-17)32-25(23)24(19)31-18-7-5-16(6-8-18)14-33(3)4/h9-13,15-16,18,35H,5-8,14H2,1-4H3,(H,30,31)/t16-,18-
Standard InChI Key: MMZHSPGVOPSOKD-SAABIXHNSA-N
Molfile:
RDKit 2D
35 38 0 0 1 0 0 0 0 0999 V2000
4.9395 -1.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8969 0.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6024 -2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3092 -5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6108 -5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9073 -5.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2081 -5.9890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2111 -7.4898 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2512 -8.0884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1729 -8.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9021 -3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6004 -2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1968 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4971 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7950 -1.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8352 -0.9063 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.7926 -3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8309 -3.6063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4923 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4904 -4.9525 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.1945 -3.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 2 0
4 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 9 1 0
14 15 2 0
15 6 1 0
15 16 1 0
17 16 1 1
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 6
21 22 1 0
22 23 1 0
22 24 1 0
20 25 1 0
25 26 1 0
26 17 1 0
12 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
29 31 2 0
31 32 1 0
31 33 1 0
33 34 1 0
33 35 2 0
35 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.03Molecular Weight (Monoisotopic): 498.2198AlogP: 6.17#Rotatable Bonds: 7Polar Surface Area: 78.35Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.66CX Basic pKa: 9.29CX LogP: 4.88CX LogD: 4.84Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -1.07
References 1. (2015) 1,5-naphthyridine derivatives and MELK inhibitors containing the same,