US8623901, 249

ID: ALA3693842

PubChem CID: 135912139

Max Phase: Preclinical

Molecular Formula: C20H21N7O2

Molecular Weight: 391.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncn(-c2ccccc2Cc2nc3c(cnn3C3CCOCC3)c(=O)[nH]2)n1

Standard InChI:  InChI=1S/C20H21N7O2/c1-13-21-12-26(25-13)17-5-3-2-4-14(17)10-18-23-19-16(20(28)24-18)11-22-27(19)15-6-8-29-9-7-15/h2-5,11-12,15H,6-10H2,1H3,(H,23,24,28)

Standard InChI Key:  RGDLMTKMHUZVNT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    8.7442   -2.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5514   -2.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8080   -1.2280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3392   -1.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1938   -3.0126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5421   -3.6405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8915   -3.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8864   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5847   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2883   -5.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2935   -3.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133    1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032    3.1233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3115    2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6928    4.0817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3384    5.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4233    6.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8628    6.1485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2175    4.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1327    3.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  2  2  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 21  1  0
 17 27  1  0
 27 28  2  0
 27 29  1  0
 29 14  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3693842

    ---

Associated Targets(Human)

PDE9A Tchem Phosphodiesterase 9A (1131 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 391.44Molecular Weight (Monoisotopic): 391.1757AlogP: 1.95#Rotatable Bonds: 4
Polar Surface Area: 103.51Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.16CX Basic pKa: 1.49CX LogP: 0.49CX LogD: 0.49
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.57Np Likeness Score: -1.57

References

1.  (2014)  Compounds for the treatment of CNS disorders, 

Source

Source(1):