US8623901, 253

ID: ALA3693846

PubChem CID: 135912143

Max Phase: Preclinical

Molecular Formula: C21H21N5O2

Molecular Weight: 375.43

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1[nH]c(Cc2ccccc2-n2cccc2)nc2c1cnn2C1CCOCC1

Standard InChI:  InChI=1S/C21H21N5O2/c27-21-17-14-22-26(16-7-11-28-12-8-16)20(17)23-19(24-21)13-15-5-1-2-6-18(15)25-9-3-4-10-25/h1-6,9-10,14,16H,7-8,11-13H2,(H,23,24,27)

Standard InChI Key:  QFLBFTRRZFIVLJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032   -3.1233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8813   -1.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9619   -2.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4014   -2.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7561   -0.5949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6713    0.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2318    0.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039    3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6005    2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9021    3.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9073    5.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6108    5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3092    5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0121    6.0043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3424    5.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3404    6.5099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5839    7.8051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1183    7.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 11  1  0
  4 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3693846

    ---

Associated Targets(Human)

PDE9A Tchem Phosphodiesterase 9A (1131 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 375.43Molecular Weight (Monoisotopic): 375.1695AlogP: 2.85#Rotatable Bonds: 4
Polar Surface Area: 77.73Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.16CX Basic pKa: 0.32CX LogP: 2.05CX LogD: 2.04
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.59Np Likeness Score: -1.61

References

1.  (2014)  Compounds for the treatment of CNS disorders, 

Source

Source(1):