The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8629158, 3 ID: ALA3693990
PubChem CID: 50903150
Max Phase: Preclinical
Molecular Formula: C24H20F3N5O
Molecular Weight: 451.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1c2c(c3ccc(-n4ccc(-c5ccc(C(F)(F)F)nn5)cc4=O)cc31)C1CCC(C2)N1
Standard InChI: InChI=1S/C24H20F3N5O/c1-31-19-12-15(3-4-16(19)23-18-5-2-14(28-18)11-20(23)31)32-9-8-13(10-22(32)33)17-6-7-21(30-29-17)24(25,26)27/h3-4,6-10,12,14,18,28H,2,5,11H2,1H3
Standard InChI Key: RZCGSPTVTKXKQB-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
-1.1402 3.1191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8985 1.9437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4584 1.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8520 1.9437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0990 1.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8324 -0.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9706 -1.3936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5403 -1.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9156 -0.4401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3117 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1552 -0.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9254 -1.7970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4474 -1.7970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1992 -0.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4474 0.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9254 0.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6999 -0.4676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4557 -1.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.9557 -1.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7000 -0.4544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.9443 0.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4443 0.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8398 1.8713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.2007 -0.4478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.9586 -1.7423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.4586 -1.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.2008 -0.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.4430 0.8647 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.9431 0.8557 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-14.7016 -0.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.3085 -1.4561 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-15.2950 0.6222 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-15.9016 -0.4131 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 1 0
10 3 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 2 1 0
16 11 1 0
14 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 17 1 0
22 23 2 0
20 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.45Molecular Weight (Monoisotopic): 451.1620AlogP: 4.15#Rotatable Bonds: 2Polar Surface Area: 64.74Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.11CX LogP: 3.00CX LogD: 0.40Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -0.68
References 1. (2014) Azabicycloalkane-indole and azabicycloalkane-pyrrolo-pyridine MCH-1 antagonists, methods of making, and use thereof,