US8629158, 9

ID: ALA3693995

PubChem CID: 58092218

Max Phase: Preclinical

Molecular Formula: C24H21FN4O2

Molecular Weight: 416.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1cc(OCc2ccc(F)cn2)ccn1-c1ccc2c3c([nH]c2c1)CC1CCC3N1

Standard InChI:  InChI=1S/C24H21FN4O2/c25-14-1-2-16(26-12-14)13-31-18-7-8-29(23(30)11-18)17-4-5-19-21(10-17)28-22-9-15-3-6-20(27-15)24(19)22/h1-2,4-5,7-8,10-12,15,20,27-28H,3,6,9,13H2

Standard InChI Key:  QBZDRCQBGMITBW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 36  0  0  0  0  0  0  0  0999 V2000
  -16.6560   -1.7265    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -15.4560   -1.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.7117   -3.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.2117   -3.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.4559   -1.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.9551   -1.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2008   -0.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7000   -0.4544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9443    0.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4443    0.8347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8398    1.8713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6999   -0.4676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4557   -1.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9557   -1.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1992   -0.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4474   -1.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9254   -1.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1552   -0.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3117    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5403   -1.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9706   -1.3936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8324   -0.2017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0990    1.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8520    1.9437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4584    1.3203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8985    1.9437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9254    0.8068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4474    0.8068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9156   -0.4401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -13.2003   -0.4426    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -14.7003   -0.4360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  2  0
 14  8  1  0
 12 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 19  2  0
 25 26  1  0
 26 27  1  0
 27 18  1  0
 27 28  2  0
 28 15  1  0
 23 29  1  0
 29 20  1  0
  5 30  1  0
 30 31  2  0
 31  2  1  0
M  END

Associated Targets(Human)

MCHR1 Tchem Melanin-concentrating hormone receptor 1 (5587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.46Molecular Weight (Monoisotopic): 416.1649AlogP: 3.78#Rotatable Bonds: 4
Polar Surface Area: 71.94Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.15CX LogP: 2.26CX LogD: -0.37
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.53Np Likeness Score: -0.64

References

1.  (2014)  Azabicycloalkane-indole and azabicycloalkane-pyrrolo-pyridine MCH-1 antagonists, methods of making, and use thereof, 

Source

Source(1):