US8629158, 10

ID: ALA3693996

PubChem CID: 50903069

Max Phase: Preclinical

Molecular Formula: C24H19F3N4O

Molecular Weight: 436.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1cc(-c2ccc(C(F)(F)F)nc2)ccn1-c1ccc2c3c([nH]c2c1)CC1CCC3N1

Standard InChI:  InChI=1S/C24H19F3N4O/c25-24(26,27)21-6-1-14(12-28-21)13-7-8-31(22(32)9-13)16-3-4-17-19(11-16)30-20-10-15-2-5-18(29-15)23(17)20/h1,3-4,6-9,11-12,15,18,29-30H,2,5,10H2

Standard InChI Key:  RWSRFWUAVDKPJQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
  -15.2994    0.6054    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -14.7017   -0.4352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.3042   -1.4729    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -15.9017   -0.4323    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -13.2008   -0.4394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.4472    0.8576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.9472    0.8533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2007   -0.4478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.9545   -1.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.4545   -1.7405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7000   -0.4544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9443    0.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4443    0.8347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8398    1.8713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6999   -0.4676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4557   -1.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9557   -1.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1992   -0.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4474   -1.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9254   -1.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1552   -0.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3117    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5403   -1.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9706   -1.3936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8324   -0.2017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0990    1.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8520    1.9437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4584    1.3203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8985    1.9437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9254    0.8068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4474    0.8068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9156   -0.4401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  2  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  2  0
 17 11  1  0
 15 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 22  2  0
 28 29  1  0
 29 30  1  0
 30 21  1  0
 30 31  2  0
 31 18  1  0
 26 32  1  0
 32 23  1  0
M  END

Associated Targets(Human)

MCHR1 Tchem Melanin-concentrating hormone receptor 1 (5587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.44Molecular Weight (Monoisotopic): 436.1511AlogP: 4.75#Rotatable Bonds: 2
Polar Surface Area: 62.71Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.15CX LogP: 3.37CX LogD: 0.75
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -0.55

References

1.  (2014)  Azabicycloalkane-indole and azabicycloalkane-pyrrolo-pyridine MCH-1 antagonists, methods of making, and use thereof, 

Source

Source(1):