US8629158, 30

ID: ALA3694009

PubChem CID: 50902011

Max Phase: Preclinical

Molecular Formula: C27H25N3O3

Molecular Weight: 439.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N1C2CCC1c1c([nH]c3cc(-n4ccc(OCc5ccccc5)cc4=O)ccc13)C2

Standard InChI:  InChI=1S/C27H25N3O3/c1-17(31)30-20-8-10-25(30)27-22-9-7-19(13-23(22)28-24(27)14-20)29-12-11-21(15-26(29)32)33-16-18-5-3-2-4-6-18/h2-7,9,11-13,15,20,25,28H,8,10,14,16H2,1H3

Standard InChI Key:  MAONPXLHUUFYAG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
    5.2192   -0.8721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1151   -1.3424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9707   -2.5337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9156   -0.4401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0990    1.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8324   -0.2017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9706   -1.3936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5403   -1.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3117    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4584    1.3203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8520    1.9437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8985    1.9437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9254    0.8068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4474    0.8068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1992   -0.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4474   -1.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9254   -1.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1552   -0.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6999   -0.4676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4399    0.8372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9398    0.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6999   -0.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9601   -1.7491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4601   -1.7608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8683   -2.8047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2007   -0.4356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.9594   -1.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.4602   -1.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.2204   -3.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.7203   -3.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.4602   -1.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.7001   -0.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.2002   -0.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  5  1  0
 10 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18  9  1  0
 18 13  1  0
 15 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 19  1  0
 24 25  2  0
 22 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  END

Associated Targets(Human)

MCHR1 Tchem Melanin-concentrating hormone receptor 1 (5587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.52Molecular Weight (Monoisotopic): 439.1896AlogP: 4.51#Rotatable Bonds: 4
Polar Surface Area: 67.33Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.86CX LogD: 2.86
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -0.51

References

1.  (2014)  Azabicycloalkane-indole and azabicycloalkane-pyrrolo-pyridine MCH-1 antagonists, methods of making, and use thereof, 

Source

Source(1):