US8716296, 3

ID: ALA3694401

PubChem CID: 59508963

Max Phase: Preclinical

Molecular Formula: C17H19FN4O2

Molecular Weight: 330.36

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(F)c1-c1cc(NC(=O)C2CCCNC2)ncn1

Standard InChI:  InChI=1S/C17H19FN4O2/c1-24-14-6-2-5-12(18)16(14)13-8-15(21-10-20-13)22-17(23)11-4-3-7-19-9-11/h2,5-6,8,10-11,19H,3-4,7,9H2,1H3,(H,20,21,22,23)

Standard InChI Key:  XAMCFOQPATUPRC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    3.6387   -0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2978   -3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2955   -5.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5925   -6.0081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5879   -7.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5467   -8.1054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8849   -8.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8826   -9.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1804  -10.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4807   -9.7683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4831   -8.2683    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1853   -7.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0048   -6.0009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3026   -5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3002   -3.7488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  9  3  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 16  1  0
 12 22  2  0
 22 23  1  0
 23 24  2  0
 24 10  1  0
M  END

Associated Targets(Human)

CDK9 Tchem Cyclin-dependent kinase 9 (2495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 330.36Molecular Weight (Monoisotopic): 330.1492AlogP: 2.23#Rotatable Bonds: 4
Polar Surface Area: 76.14Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.83CX Basic pKa: 9.57CX LogP: 1.95CX LogD: -0.01
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.90Np Likeness Score: -1.32

References

1.  (2014)  Inhibitors of protein kinases, 

Source

Source(1):