US8716296, 51

ID: ALA3694403

PubChem CID: 59509001

Max Phase: Preclinical

Molecular Formula: C19H18N4O4S

Molecular Weight: 398.44

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccccc1-c1cc(NC(=O)c2ccc(NS(C)(=O)=O)cc2)ncn1

Standard InChI:  InChI=1S/C19H18N4O4S/c1-27-17-6-4-3-5-15(17)16-11-18(21-12-20-16)22-19(24)13-7-9-14(10-8-13)23-28(2,25)26/h3-12,23H,1-2H3,(H,20,21,22,24)

Standard InChI Key:  UEDADQKVDBOYTD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    3.6387   -0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2978   -3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2955   -5.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5925   -6.0081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5879   -7.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5467   -8.1054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8849   -8.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8826   -9.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1804  -10.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4807   -9.7683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7808  -10.5181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0807   -9.7680    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1202  -10.3675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0805   -8.5680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1197   -9.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4831   -8.2683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1853   -7.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0048   -6.0009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3026   -5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3002   -3.7488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 20 22  2  0
 20 23  1  0
 18 24  1  0
 24 25  2  0
 25 15  1  0
 11 26  2  0
 26 27  1  0
 27 28  2  0
 28  9  1  0
M  END

Associated Targets(Human)

CDK9 Tchem Cyclin-dependent kinase 9 (2495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.44Molecular Weight (Monoisotopic): 398.1049AlogP: 2.78#Rotatable Bonds: 6
Polar Surface Area: 110.28Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.64CX Basic pKa: 0.99CX LogP: 1.98CX LogD: 1.96
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.66Np Likeness Score: -1.48

References

1.  (2014)  Inhibitors of protein kinases, 

Source

Source(1):